C16H24N7O+ — CID 69225379
[2-[(5-amino-1-ethylpyrazol-1-ium-4-ylidene)amino]-5-(diethylamino)phenyl]urea (PubChem CID 69225379) has the molecular formula C16H24N7O+ and a molecular weight of 330.42 g/mol. Its IUPAC name is [2-[(5-amino-1-ethylpyrazol-1-ium-4-ylidene)amino]-5-(diethylamino)phenyl]urea.
| Compound Name | [2-[(5-amino-1-ethylpyrazol-1-ium-4-ylidene)amino]-5-(diethylamino)phenyl]urea |
|---|---|
| PubChem CID | 69225379 |
| Molecular Formula | C16H24N7O+ |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | [2-[(5-amino-1-ethylpyrazol-1-ium-4-ylidene)amino]-5-(diethylamino)phenyl]urea |
| SMILES | CCN(CC)c1ccc(/N=C2/C=N[N+](CC)=C2N)c(NC(N)=O)c1 |
| InChI | InChI=1S/C16H23N7O/c1-4-22(5-2)11-7-8-12(13(9-11)21-16(18)24)20-14-10-19-23(6-3)15(14)17/h7-10H,4-6H2,1-3H3,(H4,17,18,19,21,24)/p+1 |
| InChIKey | ZEYOXNSARDSCKL-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|