C32H45N9O8S2 — CID 91553214
methanesulfonoperoxoate;[1-methyl-3-[5-[3-methyl-2-[(4-methylphenyl)diazenyl]imidazol-3-ium-1-yl]pentyl]imidazol-1-ium-2-yl]-(4-pyrrolidin-1-ylphenyl)diazene (PubChem CID 91553214) has the molecular formula C32H45N9O8S2 and a molecular weight of 747.90 g/mol. Its IUPAC name is methanesulfonoperoxoate;[1-methyl-3-[5-[3-methyl-2-[(4-methylphenyl)diazenyl]imidazol-3-ium-1-yl]pentyl]imidazol-1-ium-2-yl]-(4-pyrrolidin-1-ylphenyl)diazene.
| Compound Name | methanesulfonoperoxoate;[1-methyl-3-[5-[3-methyl-2-[(4-methylphenyl)diazenyl]imidazol-3-ium-1-yl]pentyl]imidazol-1-ium-2-yl]-(4-pyrrolidin-1-ylphenyl)diazene |
|---|---|
| PubChem CID | 91553214 |
| Molecular Formula | C32H45N9O8S2 |
| Molecular Weight | 747.90 g/mol |
| Exact Mass | 747.28 |
| IUPAC Name | methanesulfonoperoxoate;[1-methyl-3-[5-[3-methyl-2-[(4-methylphenyl)diazenyl]imidazol-3-ium-1-yl]pentyl]imidazol-1-ium-2-yl]-(4-pyrrolidin-1-ylphenyl)diazene |
| SMILES | CS(=O)(=O)O[O-].CS(=O)(=O)O[O-].Cc1ccc(/N=N/c2n(CCCCCn3cc[n+](C)c3/N=N/c3ccc(N4CCCC4)cc3)cc[n+]2C)cc1 |
| InChI | InChI=1S/C30H39N9.2CH4O4S/c1-25-9-11-26(12-10-25)31-33-29-35(2)21-23-38(29)19-5-4-6-20-39-24-22-36(3)30(39)34-32-27-13-15-28(16-14-27)37-17-7-8-18-37;2*1-6(3,4)5-2/h9-16,21-24H,4-8,17-20H2,1-3H3;2*2H,1H3/q+2;;/p-2 |
| InChIKey | DIBJSSFNBPMFKC-UHFFFAOYSA-L |
| XLogP | 3.02 |
| TPSA | 203.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.90 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|