C42H48N12O2+2 — CID 58671696
N-[4-[4-[[1-[6-[2-[[4-(4-acetamidoanilino)phenyl]diazenyl]-3-methylimidazol-3-ium-1-yl]hexyl]-3-methylimidazol-3-ium-2-yl]diazenyl]anilino]phenyl]acetamide (PubChem CID 58671696) has the molecular formula C42H48N12O2+2 and a molecular weight of 752.93 g/mol. Its IUPAC name is N-[4-[4-[[1-[6-[2-[[4-(4-acetamidoanilino)phenyl]diazenyl]-3-methylimidazol-3-ium-1-yl]hexyl]-3-methylimidazol-3-ium-2-yl]diazenyl]anilino]phenyl]acetamide.
| Compound Name | N-[4-[4-[[1-[6-[2-[[4-(4-acetamidoanilino)phenyl]diazenyl]-3-methylimidazol-3-ium-1-yl]hexyl]-3-methylimidazol-3-ium-2-yl]diazenyl]anilino]phenyl]acetamide |
|---|---|
| PubChem CID | 58671696 |
| Molecular Formula | C42H48N12O2+2 |
| Molecular Weight | 752.93 g/mol |
| Exact Mass | 752.40 |
| IUPAC Name | N-[4-[4-[[1-[6-[2-[[4-(4-acetamidoanilino)phenyl]diazenyl]-3-methylimidazol-3-ium-1-yl]hexyl]-3-methylimidazol-3-ium-2-yl]diazenyl]anilino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2ccc(/N=N/c3n(CCCCCCn4cc[n+](C)c4/N=N/c4ccc(Nc5ccc(NC(C)=O)cc5)cc4)cc[n+]3C)cc2)cc1 |
| InChI | InChI=1S/C42H46N12O2/c1-31(55)43-33-9-13-35(14-10-33)45-37-17-21-39(22-18-37)47-49-41-51(3)27-29-53(41)25-7-5-6-8-26-54-30-28-52(4)42(54)50-48-40-23-19-38(20-24-40)46-36-15-11-34(12-16-36)44-32(2)56/h9-24,27-30H,5-8,25-26H2,1-4H3,(H2,43,44,47,48,55,56)/p+2 |
| InChIKey | JUEAIVKXWPWSID-UHFFFAOYSA-P |
| XLogP | 9.43 |
| TPSA | 149.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.93 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|