C17H19ClN8O — CID 88717442
N-[4-[4-[(1,4-dimethyltetrazol-1-ium-5-yl)diazenyl]anilino]phenyl]acetamide chloride (PubChem CID 88717442) has the molecular formula C17H19ClN8O and a molecular weight of 386.85 g/mol. Its IUPAC name is N-[4-[4-[(1,4-dimethyltetrazol-1-ium-5-yl)diazenyl]anilino]phenyl]acetamide chloride.
| Compound Name | N-[4-[4-[(1,4-dimethyltetrazol-1-ium-5-yl)diazenyl]anilino]phenyl]acetamide chloride |
|---|---|
| PubChem CID | 88717442 |
| Molecular Formula | C17H19ClN8O |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[4-[4-[(1,4-dimethyltetrazol-1-ium-5-yl)diazenyl]anilino]phenyl]acetamide chloride |
| SMILES | CC(=O)Nc1ccc(Nc2ccc(/N=N/c3n(C)nn[n+]3C)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C17H18N8O.ClH/c1-12(26)18-13-4-6-14(7-5-13)19-15-8-10-16(11-9-15)20-21-17-24(2)22-23-25(17)3;/h4-11H,1-3H3,(H,18,20,26);1H |
| InChIKey | PUXPQZZFGXLDFV-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|