C18H27BN6O+ — CID 140900674
CID 140900674 (PubChem CID 140900674) has the molecular formula C18H27BN6O+ and a molecular weight of 354.27 g/mol.
| Compound Name | CID 140900674 |
|---|---|
| PubChem CID | 140900674 |
| Molecular Formula | C18H27BN6O+ |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc(/N=N/c2n(CCCCCN[B]C=O)cc[n+]2C)cc1 |
| InChI | InChI=1S/C18H27BN6O/c1-23(2)17-9-7-16(8-10-17)21-22-18-24(3)13-14-25(18)12-6-4-5-11-20-19-15-26/h7-10,13-15,20H,4-6,11-12H2,1-3H3/q+1 |
| InChIKey | MFBMUPXYRPIEBT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 65.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|