C35H60N7O4+ — CID 122549241
tert-butyl N-[3-[4-[(1,3-dipentylimidazol-1-ium-2-yl)diazenyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]anilino]propyl]carbamate (PubChem CID 122549241) has the molecular formula C35H60N7O4+ and a molecular weight of 642.91 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[(1,3-dipentylimidazol-1-ium-2-yl)diazenyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]anilino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[(1,3-dipentylimidazol-1-ium-2-yl)diazenyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]anilino]propyl]carbamate |
|---|---|
| PubChem CID | 122549241 |
| Molecular Formula | C35H60N7O4+ |
| Molecular Weight | 642.91 g/mol |
| Exact Mass | 642.47 |
| IUPAC Name | tert-butyl N-[3-[4-[(1,3-dipentylimidazol-1-ium-2-yl)diazenyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]anilino]propyl]carbamate |
| SMILES | CCCCCn1cc[n+](CCCCC)c1/N=N/c1ccc(N(CCCNC(=O)OC(C)(C)C)CCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C35H59N7O4/c1-9-11-13-23-41-27-28-42(24-14-12-10-2)31(41)39-38-29-17-19-30(20-18-29)40(25-15-21-36-32(43)45-34(3,4)5)26-16-22-37-33(44)46-35(6,7)8/h17-20,27-28H,9-16,21-26H2,1-8H3,(H-,36,37,43,44)/p+1 |
| InChIKey | IFNFXQDPNFPNEI-UHFFFAOYSA-O |
| XLogP | 8.21 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.91 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|