C18H24FN5O2 — CID 142740624
tert-butyl N-[3-[4-[(4-fluorophenyl)diazenyl]-2-methylimidazol-1-yl]propyl]carbamate (PubChem CID 142740624) has the molecular formula C18H24FN5O2 and a molecular weight of 361.42 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[(4-fluorophenyl)diazenyl]-2-methylimidazol-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[(4-fluorophenyl)diazenyl]-2-methylimidazol-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 142740624 |
| Molecular Formula | C18H24FN5O2 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | tert-butyl N-[3-[4-[(4-fluorophenyl)diazenyl]-2-methylimidazol-1-yl]propyl]carbamate |
| SMILES | Cc1nc(/N=N/c2ccc(F)cc2)cn1CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24FN5O2/c1-13-21-16(23-22-15-8-6-14(19)7-9-15)12-24(13)11-5-10-20-17(25)26-18(2,3)4/h6-9,12H,5,10-11H2,1-4H3,(H,20,25)/b23-22+ |
| InChIKey | SLTCDYWUPTTXAT-GHVJWSGMSA-N |
| XLogP | 4.66 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|