C18H22FN3O5 — CID 8948397
[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 8948397) has the molecular formula C18H22FN3O5 and a molecular weight of 379.39 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | [3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 8948397 |
| Molecular Formula | C18H22FN3O5 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)OCc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C18H22FN3O5/c1-18(2,3)26-17(24)20-10-4-5-15(23)25-11-14-21-16(22-27-14)12-6-8-13(19)9-7-12/h6-9H,4-5,10-11H2,1-3H3,(H,20,24) |
| InChIKey | RKBUABOIWPFZLW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|