C28H44N4O4 — CID 170422176
tert-butyl N-[4-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-4-oxobutyl]carbamate (PubChem CID 170422176) has the molecular formula C28H44N4O4 and a molecular weight of 500.68 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 170422176 |
| Molecular Formula | C28H44N4O4 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | tert-butyl N-[4-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-4-oxobutyl]carbamate |
| SMILES | CCCCCCCCCCc1ccc(-c2noc(CNC(=O)CCCNC(=O)OC(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C28H44N4O4/c1-5-6-7-8-9-10-11-12-14-22-16-18-23(19-17-22)26-31-25(36-32-26)21-30-24(33)15-13-20-29-27(34)35-28(2,3)4/h16-19H,5-15,20-21H2,1-4H3,(H,29,34)(H,30,33) |
| InChIKey | XPLKVALIKAFDSQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|