C25H38N4O4 — CID 170355190
5-amino-6-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-6-oxohexanoic acid (PubChem CID 170355190) has the molecular formula C25H38N4O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is 5-amino-6-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-6-oxohexanoic acid.
| Compound Name | 5-amino-6-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 170355190 |
| Molecular Formula | C25H38N4O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 5-amino-6-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-6-oxohexanoic acid |
| SMILES | CCCCCCCCCCc1ccc(-c2noc(CNC(=O)C(N)CCCC(=O)O)n2)cc1 |
| InChI | InChI=1S/C25H38N4O4/c1-2-3-4-5-6-7-8-9-11-19-14-16-20(17-15-19)24-28-22(33-29-24)18-27-25(32)21(26)12-10-13-23(30)31/h14-17,21H,2-13,18,26H2,1H3,(H,27,32)(H,30,31) |
| InChIKey | DEWTXCUCXGICHN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|