C26H40N4O4 — CID 170355423
[(2S)-1-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-4-methyl-1-oxopentan-2-yl]carbamic acid (PubChem CID 170355423) has the molecular formula C26H40N4O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is [(2S)-1-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-4-methyl-1-oxopentan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-4-methyl-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 170355423 |
| Molecular Formula | C26H40N4O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | [(2S)-1-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-4-methyl-1-oxopentan-2-yl]carbamic acid |
| SMILES | CCCCCCCCCCc1ccc(-c2noc(CNC(=O)[C@H](CC(C)C)NC(=O)O)n2)cc1 |
| InChI | InChI=1S/C26H40N4O4/c1-4-5-6-7-8-9-10-11-12-20-13-15-21(16-14-20)24-29-23(34-30-24)18-27-25(31)22(17-19(2)3)28-26(32)33/h13-16,19,22,28H,4-12,17-18H2,1-3H3,(H,27,31)(H,32,33)/t22-/m0/s1 |
| InChIKey | PUVJYYGYPGKJRT-QFIPXVFZSA-N |
| XLogP | 5.72 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|