C20H30N4O3 — CID 66988783
2-amino-N-[[4-(5-heptyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-4-hydroxybutanamide (PubChem CID 66988783) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-amino-N-[[4-(5-heptyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-4-hydroxybutanamide.
| Compound Name | 2-amino-N-[[4-(5-heptyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-4-hydroxybutanamide |
|---|---|
| PubChem CID | 66988783 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 2-amino-N-[[4-(5-heptyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-4-hydroxybutanamide |
| SMILES | CCCCCCCc1nc(-c2ccc(CNC(=O)C(N)CCO)cc2)no1 |
| InChI | InChI=1S/C20H30N4O3/c1-2-3-4-5-6-7-18-23-19(24-27-18)16-10-8-15(9-11-16)14-22-20(26)17(21)12-13-25/h8-11,17,25H,2-7,12-14,21H2,1H3,(H,22,26) |
| InChIKey | ZJNLUYOVUXGXHQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|