C22H34N4O3 — CID 170355360
(2S)-2-amino-N-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-hydroxypropanamide (PubChem CID 170355360) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is (2S)-2-amino-N-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-hydroxypropanamide.
| Compound Name | (2S)-2-amino-N-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 170355360 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (2S)-2-amino-N-[[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-hydroxypropanamide |
| SMILES | CCCCCCCCCCc1ccc(-c2noc(CNC(=O)[C@@H](N)CO)n2)cc1 |
| InChI | InChI=1S/C22H34N4O3/c1-2-3-4-5-6-7-8-9-10-17-11-13-18(14-12-17)21-25-20(29-26-21)15-24-22(28)19(23)16-27/h11-14,19,27H,2-10,15-16,23H2,1H3,(H,24,28)/t19-/m0/s1 |
| InChIKey | YDVKUXUKZHLGAP-IBGZPJMESA-N |
| XLogP | 3.36 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|