C28H45N3O3 — CID 170522304
tert-butyl N-[(2R)-1-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]-3-methylbutan-2-yl]carbamate (PubChem CID 170522304) has the molecular formula C28H45N3O3 and a molecular weight of 471.69 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]-3-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 170522304 |
| Molecular Formula | C28H45N3O3 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.35 |
| IUPAC Name | tert-butyl N-[(2R)-1-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]-3-methylbutan-2-yl]carbamate |
| SMILES | CCCCCCCCCCc1ccc(-c2noc(C[C@@H](NC(=O)OC(C)(C)C)C(C)C)n2)cc1 |
| InChI | InChI=1S/C28H45N3O3/c1-7-8-9-10-11-12-13-14-15-22-16-18-23(19-17-22)26-30-25(34-31-26)20-24(21(2)3)29-27(32)33-28(4,5)6/h16-19,21,24H,7-15,20H2,1-6H3,(H,29,32)/t24-/m1/s1 |
| InChIKey | BOCOAMHFRRSUHT-XMMPIXPASA-N |
| XLogP | 7.51 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|