C29H45N3O3 — CID 154660843
tert-butyl 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]azepane-1-carboxylate (PubChem CID 154660843) has the molecular formula C29H45N3O3 and a molecular weight of 483.70 g/mol. Its IUPAC name is tert-butyl 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]azepane-1-carboxylate.
| Compound Name | tert-butyl 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 154660843 |
| Molecular Formula | C29H45N3O3 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | tert-butyl 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]azepane-1-carboxylate |
| SMILES | CCCCCCCCCCc1ccc(-c2noc(C3CCCCN(C(=O)OC(C)(C)C)C3)n2)cc1 |
| InChI | InChI=1S/C29H45N3O3/c1-5-6-7-8-9-10-11-12-15-23-17-19-24(20-18-23)26-30-27(35-31-26)25-16-13-14-21-32(22-25)28(33)34-29(2,3)4/h17-20,25H,5-16,21-22H2,1-4H3 |
| InChIKey | PSVHNEMFVQRNAG-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|