C32H49N5O5 — CID 118255418
tert-butyl-[C-[(2S)-2-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]azetidin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]carbamic acid (PubChem CID 118255418) has the molecular formula C32H49N5O5 and a molecular weight of 583.77 g/mol. Its IUPAC name is tert-butyl-[C-[(2S)-2-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]azetidin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]carbamic acid.
| Compound Name | tert-butyl-[C-[(2S)-2-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]azetidin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]carbamic acid |
|---|---|
| PubChem CID | 118255418 |
| Molecular Formula | C32H49N5O5 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.37 |
| IUPAC Name | tert-butyl-[C-[(2S)-2-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]azetidin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]carbamic acid |
| SMILES | CCCCCCCCCCc1ccc(-c2noc([C@@H]3CCN3C(=NC(=O)OC(C)(C)C)N(C(=O)O)C(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C32H49N5O5/c1-8-9-10-11-12-13-14-15-16-23-17-19-24(20-18-23)26-33-27(42-35-26)25-21-22-36(25)28(34-29(38)41-32(5,6)7)37(30(39)40)31(2,3)4/h17-20,25H,8-16,21-22H2,1-7H3,(H,39,40)/t25-/m0/s1 |
| InChIKey | RETXJGOLDLWQGK-VWLOTQADSA-N |
| XLogP | 8.24 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|