C31H47N5O5 — CID 140681250
tert-butyl (NE)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(2S)-2-[5-(4-octylphenyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]methylidene]carbamate (PubChem CID 140681250) has the molecular formula C31H47N5O5 and a molecular weight of 569.75 g/mol. Its IUPAC name is tert-butyl (NE)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(2S)-2-[5-(4-octylphenyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(2S)-2-[5-(4-octylphenyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 140681250 |
| Molecular Formula | C31H47N5O5 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.36 |
| IUPAC Name | tert-butyl (NE)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(2S)-2-[5-(4-octylphenyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]methylidene]carbamate |
| SMILES | CCCCCCCCc1ccc(-c2nc([C@@H]3CCCN3/C(=N/C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)no2)cc1 |
| InChI | InChI=1S/C31H47N5O5/c1-8-9-10-11-12-13-15-22-17-19-23(20-18-22)26-32-25(35-41-26)24-16-14-21-36(24)27(33-28(37)39-30(2,3)4)34-29(38)40-31(5,6)7/h17-20,24H,8-16,21H2,1-7H3,(H,33,34,37,38)/t24-/m0/s1 |
| InChIKey | ZINGHVCDOQMOAD-DEOSSOPVSA-N |
| XLogP | 7.59 |
| TPSA | 119.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|