C32H46F3N5O5 — CID 154661112
tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[3-[3-[4-nonyl-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]azetidin-1-yl]methylidene]carbamate (PubChem CID 154661112) has the molecular formula C32H46F3N5O5 and a molecular weight of 637.74 g/mol. Its IUPAC name is tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[3-[3-[4-nonyl-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]azetidin-1-yl]methylidene]carbamate.
| Compound Name | tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[3-[3-[4-nonyl-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]azetidin-1-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 154661112 |
| Molecular Formula | C32H46F3N5O5 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.35 |
| IUPAC Name | tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[3-[3-[4-nonyl-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]azetidin-1-yl]methylidene]carbamate |
| SMILES | CCCCCCCCCc1ccc(-c2noc(C3CN(C(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C3)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C32H46F3N5O5/c1-8-9-10-11-12-13-14-15-21-16-17-22(18-24(21)32(33,34)35)25-36-26(45-39-25)23-19-40(20-23)27(37-28(41)43-30(2,3)4)38-29(42)44-31(5,6)7/h16-18,23H,8-15,19-20H2,1-7H3,(H,37,38,41,42) |
| InChIKey | FLJWGVXHFNGTGM-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 119.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|