C26H37N5O5S — CID 136655961
tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(2S)-2-[3-[4-(3-sulfanylpropyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methylidene]carbamate (PubChem CID 136655961) has the molecular formula C26H37N5O5S and a molecular weight of 531.68 g/mol. Its IUPAC name is tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(2S)-2-[3-[4-(3-sulfanylpropyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methylidene]carbamate.
| Compound Name | tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(2S)-2-[3-[4-(3-sulfanylpropyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 136655961 |
| Molecular Formula | C26H37N5O5S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(2S)-2-[3-[4-(3-sulfanylpropyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(NC(=O)OC(C)(C)C)N1CCC[C@H]1c1nc(-c2ccc(CCCS)cc2)no1 |
| InChI | InChI=1S/C26H37N5O5S/c1-25(2,3)34-23(32)28-22(29-24(33)35-26(4,5)6)31-15-7-10-19(31)21-27-20(30-36-21)18-13-11-17(12-14-18)9-8-16-37/h11-14,19,37H,7-10,15-16H2,1-6H3,(H,28,29,32,33)/t19-/m0/s1 |
| InChIKey | FVVKBQDBYDKHEG-IBGZPJMESA-N |
| XLogP | 5.55 |
| TPSA | 119.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|