C31H44N6O5 — CID 154405490
tert-butyl N-[[(2S)-2-[3-(1-hexylindol-3-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 154405490) has the molecular formula C31H44N6O5 and a molecular weight of 580.73 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-2-[3-(1-hexylindol-3-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
| Compound Name | tert-butyl N-[[(2S)-2-[3-(1-hexylindol-3-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 154405490 |
| Molecular Formula | C31H44N6O5 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | tert-butyl N-[[(2S)-2-[3-(1-hexylindol-3-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | CCCCCCn1cc(-c2noc([C@@H]3CCCN3C(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)n2)c2ccccc21 |
| InChI | InChI=1S/C31H44N6O5/c1-8-9-10-13-18-36-20-22(21-15-11-12-16-23(21)36)25-32-26(42-35-25)24-17-14-19-37(24)27(33-28(38)40-30(2,3)4)34-29(39)41-31(5,6)7/h11-12,15-16,20,24H,8-10,13-14,17-19H2,1-7H3,(H,33,34,38,39)/t24-/m0/s1 |
| InChIKey | IZJYNAKKDBSIJB-DEOSSOPVSA-N |
| XLogP | 7.22 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|