C26H39N3O3 — CID 154660982
tert-butyl (3R)-3-[3-(4-nonylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxylate (PubChem CID 154660982) has the molecular formula C26H39N3O3 and a molecular weight of 441.62 g/mol. Its IUPAC name is tert-butyl (3R)-3-[3-(4-nonylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[3-(4-nonylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154660982 |
| Molecular Formula | C26H39N3O3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | tert-butyl (3R)-3-[3-(4-nonylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCCc1ccc(-c2noc([C@@H]3CCN(C(=O)OC(C)(C)C)C3)n2)cc1 |
| InChI | InChI=1S/C26H39N3O3/c1-5-6-7-8-9-10-11-12-20-13-15-21(16-14-20)23-27-24(32-28-23)22-17-18-29(19-22)25(30)31-26(2,3)4/h13-16,22H,5-12,17-19H2,1-4H3/t22-/m1/s1 |
| InChIKey | ZLIQZXSXWVPQQG-JOCHJYFZSA-N |
| XLogP | 6.75 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|