C27H42N4O4 — CID 170522309
tert-butyl N-[2-[2-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]ethylamino]-2-oxoethyl]carbamate (PubChem CID 170522309) has the molecular formula C27H42N4O4 and a molecular weight of 486.66 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 170522309 |
| Molecular Formula | C27H42N4O4 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | tert-butyl N-[2-[2-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]ethylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCCCCCCc1ccc(-c2noc(CCNC(=O)CNC(=O)OC(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C27H42N4O4/c1-5-6-7-8-9-10-11-12-13-21-14-16-22(17-15-21)25-30-24(35-31-25)18-19-28-23(32)20-29-26(33)34-27(2,3)4/h14-17H,5-13,18-20H2,1-4H3,(H,28,32)(H,29,33) |
| InChIKey | BQAZMIIBGSVPPQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|