C30H51N3O2 — CID 162755663
1-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]-N-methylmethanamine;(2R)-2-ethyl-5-methylheptanal (PubChem CID 162755663) has the molecular formula C30H51N3O2 and a molecular weight of 485.76 g/mol. Its IUPAC name is 1-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]-N-methylmethanamine;(2R)-2-ethyl-5-methylheptanal.
| Compound Name | 1-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]-N-methylmethanamine;(2R)-2-ethyl-5-methylheptanal |
|---|---|
| PubChem CID | 162755663 |
| Molecular Formula | C30H51N3O2 |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 485.40 |
| IUPAC Name | 1-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]-N-methylmethanamine;(2R)-2-ethyl-5-methylheptanal |
| SMILES | CCC(C)CC[C@H](C=O)CC.CCCCCCCCCCc1ccc(-c2noc(CNC)n2)cc1 |
| InChI | InChI=1S/C20H31N3O.C10H20O/c1-3-4-5-6-7-8-9-10-11-17-12-14-18(15-13-17)20-22-19(16-21-2)24-23-20;1-4-9(3)6-7-10(5-2)8-11/h12-15,21H,3-11,16H2,1-2H3;8-10H,4-7H2,1-3H3/t;9?,10-/m.1/s1 |
| InChIKey | MPIXVGRKTQVPTR-BGVCWTHRSA-N |
| XLogP | 8.18 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|