C16H22FN3O2 — CID 87780041
tert-butyl N-[4-[(4-fluorophenyl)iminomethylideneamino]butyl]carbamate (PubChem CID 87780041) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is tert-butyl N-[4-[(4-fluorophenyl)iminomethylideneamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(4-fluorophenyl)iminomethylideneamino]butyl]carbamate |
|---|---|
| PubChem CID | 87780041 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | tert-butyl N-[4-[(4-fluorophenyl)iminomethylideneamino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCN=C=Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H22FN3O2/c1-16(2,3)22-15(21)19-11-5-4-10-18-12-20-14-8-6-13(17)7-9-14/h6-9H,4-5,10-11H2,1-3H3,(H,19,21) |
| InChIKey | OYSUJLKJQNNGOT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|