C17H27FN2O2 — CID 107248141
tert-butyl N-[2-[1-(4-fluorophenyl)propylamino]propyl]carbamate (PubChem CID 107248141) has the molecular formula C17H27FN2O2 and a molecular weight of 310.41 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(4-fluorophenyl)propylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(4-fluorophenyl)propylamino]propyl]carbamate |
|---|---|
| PubChem CID | 107248141 |
| Molecular Formula | C17H27FN2O2 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | tert-butyl N-[2-[1-(4-fluorophenyl)propylamino]propyl]carbamate |
| SMILES | CCC(NC(C)CNC(=O)OC(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H27FN2O2/c1-6-15(13-7-9-14(18)10-8-13)20-12(2)11-19-16(21)22-17(3,4)5/h7-10,12,15,20H,6,11H2,1-5H3,(H,19,21) |
| InChIKey | HOXUSPADPAATHL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |