C14H28N4O2 — CID 138393789
tert-butyl N-(9-azidononyl)carbamate (PubChem CID 138393789) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is tert-butyl N-(9-azidononyl)carbamate.
| Compound Name | tert-butyl N-(9-azidononyl)carbamate |
|---|---|
| PubChem CID | 138393789 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | tert-butyl N-(9-azidononyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C14H28N4O2/c1-14(2,3)20-13(19)16-11-9-7-5-4-6-8-10-12-17-18-15/h4-12H2,1-3H3,(H,16,19) |
| InChIKey | BBOSBJPEOGMFBY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|