C24H38FN3O4 — CID 11144852
tert-butyl N-[3-[(4-fluorophenyl)methylideneamino]propyl]-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate (PubChem CID 11144852) has the molecular formula C24H38FN3O4 and a molecular weight of 451.58 g/mol. Its IUPAC name is tert-butyl N-[3-[(4-fluorophenyl)methylideneamino]propyl]-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[3-[(4-fluorophenyl)methylideneamino]propyl]-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate |
|---|---|
| PubChem CID | 11144852 |
| Molecular Formula | C24H38FN3O4 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | tert-butyl N-[3-[(4-fluorophenyl)methylideneamino]propyl]-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCN(CCC/N=C/c1ccc(F)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38FN3O4/c1-23(2,3)31-21(29)27-15-7-8-16-28(22(30)32-24(4,5)6)17-9-14-26-18-19-10-12-20(25)13-11-19/h10-13,18H,7-9,14-17H2,1-6H3,(H,27,29)/b26-18+ |
| InChIKey | SFIBACHDPROYKQ-NLRVBDNBSA-N |
| XLogP | 5.18 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|