C23H39N8O3+ — CID 158591249
tert-butyl 5-[4-[[1-(3-acetamidopropyl)-3-propylimidazol-3-ium-2-yl]diazenyl]-5-aminopyrazol-1-yl]pentanoate (PubChem CID 158591249) has the molecular formula C23H39N8O3+ and a molecular weight of 475.62 g/mol. Its IUPAC name is tert-butyl 5-[4-[[1-(3-acetamidopropyl)-3-propylimidazol-3-ium-2-yl]diazenyl]-5-aminopyrazol-1-yl]pentanoate.
| Compound Name | tert-butyl 5-[4-[[1-(3-acetamidopropyl)-3-propylimidazol-3-ium-2-yl]diazenyl]-5-aminopyrazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 158591249 |
| Molecular Formula | C23H39N8O3+ |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | tert-butyl 5-[4-[[1-(3-acetamidopropyl)-3-propylimidazol-3-ium-2-yl]diazenyl]-5-aminopyrazol-1-yl]pentanoate |
| SMILES | CCC[n+]1ccn(CCCNC(C)=O)c1/N=N/c1cnn(CCCCC(=O)OC(C)(C)C)c1N |
| InChI | InChI=1S/C23H38N8O3/c1-6-12-29-15-16-30(13-9-11-25-18(2)32)22(29)28-27-19-17-26-31(21(19)24)14-8-7-10-20(33)34-23(3,4)5/h15-17,24H,6-14H2,1-5H3,(H,25,32)/p+1 |
| InChIKey | OPHFSQZIPNLMJF-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 132.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|