C21H34Cl2N7+ — CID 137315374
[1,3-bis(3-chloropropyl)imidazol-1-ium-2-yl]-(4-hexyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-3-yl)diazene (PubChem CID 137315374) has the molecular formula C21H34Cl2N7+ and a molecular weight of 455.46 g/mol. Its IUPAC name is [1,3-bis(3-chloropropyl)imidazol-1-ium-2-yl]-(4-hexyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-3-yl)diazene.
| Compound Name | [1,3-bis(3-chloropropyl)imidazol-1-ium-2-yl]-(4-hexyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-3-yl)diazene |
|---|---|
| PubChem CID | 137315374 |
| Molecular Formula | C21H34Cl2N7+ |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | [1,3-bis(3-chloropropyl)imidazol-1-ium-2-yl]-(4-hexyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-3-yl)diazene |
| SMILES | CCCCCCN1CCCn2ncc(/N=N/c3n(CCCCl)cc[n+]3CCCCl)c21 |
| InChI | InChI=1S/C21H34Cl2N7/c1-2-3-4-5-11-27-14-8-15-30-20(27)19(18-24-30)25-26-21-28(12-6-9-22)16-17-29(21)13-7-10-23/h16-18H,2-15H2,1H3/q+1 |
| InChIKey | OROGHQJRQSAULH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 54.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|