C29H53N8+3 — CID 140890689
4-[3-(4-azaniumylbutyl)-2-[(1,4-dipentyl-2,3-dihydroquinoxalin-6-yl)diazenyl]imidazol-1-ium-1-yl]butylazanium (PubChem CID 140890689) has the molecular formula C29H53N8+3 and a molecular weight of 513.80 g/mol. Its IUPAC name is 4-[3-(4-azaniumylbutyl)-2-[(1,4-dipentyl-2,3-dihydroquinoxalin-6-yl)diazenyl]imidazol-1-ium-1-yl]butylazanium.
| Compound Name | 4-[3-(4-azaniumylbutyl)-2-[(1,4-dipentyl-2,3-dihydroquinoxalin-6-yl)diazenyl]imidazol-1-ium-1-yl]butylazanium |
|---|---|
| PubChem CID | 140890689 |
| Molecular Formula | C29H53N8+3 |
| Molecular Weight | 513.80 g/mol |
| Exact Mass | 513.44 |
| IUPAC Name | 4-[3-(4-azaniumylbutyl)-2-[(1,4-dipentyl-2,3-dihydroquinoxalin-6-yl)diazenyl]imidazol-1-ium-1-yl]butylazanium |
| SMILES | CCCCCN1CCN(CCCCC)c2cc(/N=N/c3n(CCCC[NH3+])cc[n+]3CCCC[NH3+])ccc21 |
| InChI | InChI=1S/C29H51N8/c1-3-5-9-17-34-21-22-35(18-10-6-4-2)28-25-26(13-14-27(28)34)32-33-29-36(19-11-7-15-30)23-24-37(29)20-12-8-16-31/h13-14,23-25H,3-12,15-22,30-31H2,1-2H3/q+1/p+2 |
| InChIKey | IVWNDSGGYFJUPX-UHFFFAOYSA-P |
| XLogP | 4.24 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.80 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|