C23H41N8+3 — CID 140852939
4-[3-(4-azaniumylbutyl)-2-[(1,4-diethyl-2,3-dihydroquinoxalin-6-yl)diazenyl]imidazol-1-ium-1-yl]butylazanium (PubChem CID 140852939) has the molecular formula C23H41N8+3 and a molecular weight of 429.64 g/mol. Its IUPAC name is 4-[3-(4-azaniumylbutyl)-2-[(1,4-diethyl-2,3-dihydroquinoxalin-6-yl)diazenyl]imidazol-1-ium-1-yl]butylazanium.
| Compound Name | 4-[3-(4-azaniumylbutyl)-2-[(1,4-diethyl-2,3-dihydroquinoxalin-6-yl)diazenyl]imidazol-1-ium-1-yl]butylazanium |
|---|---|
| PubChem CID | 140852939 |
| Molecular Formula | C23H41N8+3 |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | 4-[3-(4-azaniumylbutyl)-2-[(1,4-diethyl-2,3-dihydroquinoxalin-6-yl)diazenyl]imidazol-1-ium-1-yl]butylazanium |
| SMILES | CCN1CCN(CC)c2cc(/N=N/c3n(CCCC[NH3+])cc[n+]3CCCC[NH3+])ccc21 |
| InChI | InChI=1S/C23H39N8/c1-3-28-15-16-29(4-2)22-19-20(9-10-21(22)28)26-27-23-30(13-7-5-11-24)17-18-31(23)14-8-6-12-25/h9-10,17-19H,3-8,11-16,24-25H2,1-2H3/q+1/p+2 |
| InChIKey | HRRCWWKQFUCQNM-UHFFFAOYSA-P |
| XLogP | 1.90 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|