C29H53N8+ — CID 134355047
4-[3-(4-aminobutyl)-2-[2-(1,4-dipentyl-2,3-dihydroquinoxalin-6-yl)hydrazinyl]imidazol-3-ium-1-yl]butan-1-amine (PubChem CID 134355047) has the molecular formula C29H53N8+ and a molecular weight of 513.80 g/mol. Its IUPAC name is 4-[3-(4-aminobutyl)-2-[2-(1,4-dipentyl-2,3-dihydroquinoxalin-6-yl)hydrazinyl]imidazol-3-ium-1-yl]butan-1-amine.
| Compound Name | 4-[3-(4-aminobutyl)-2-[2-(1,4-dipentyl-2,3-dihydroquinoxalin-6-yl)hydrazinyl]imidazol-3-ium-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 134355047 |
| Molecular Formula | C29H53N8+ |
| Molecular Weight | 513.80 g/mol |
| Exact Mass | 513.44 |
| IUPAC Name | 4-[3-(4-aminobutyl)-2-[2-(1,4-dipentyl-2,3-dihydroquinoxalin-6-yl)hydrazinyl]imidazol-3-ium-1-yl]butan-1-amine |
| SMILES | CCCCCN1CCN(CCCCC)c2cc(NNc3n(CCCCN)cc[n+]3CCCCN)ccc21 |
| InChI | InChI=1S/C29H52N8/c1-3-5-9-17-34-21-22-35(18-10-6-4-2)28-25-26(13-14-27(28)34)32-33-29-36(19-11-7-15-30)23-24-37(29)20-12-8-16-31/h13-14,23-25,32H,3-12,15-22,30-31H2,1-2H3/p+1 |
| InChIKey | LSFIIYIARJNJCP-UHFFFAOYSA-O |
| XLogP | 4.70 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.80 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|