C15H28N9+ — CID 140852027
1-(3-aminopropyl)-4-[[1-(3-aminopropyl)-3-propylimidazol-3-ium-2-yl]diazenyl]pyrazol-5-amine (PubChem CID 140852027) has the molecular formula C15H28N9+ and a molecular weight of 334.45 g/mol. Its IUPAC name is 1-(3-aminopropyl)-4-[[1-(3-aminopropyl)-3-propylimidazol-3-ium-2-yl]diazenyl]pyrazol-5-amine.
| Compound Name | 1-(3-aminopropyl)-4-[[1-(3-aminopropyl)-3-propylimidazol-3-ium-2-yl]diazenyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 140852027 |
| Molecular Formula | C15H28N9+ |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 1-(3-aminopropyl)-4-[[1-(3-aminopropyl)-3-propylimidazol-3-ium-2-yl]diazenyl]pyrazol-5-amine |
| SMILES | CCC[n+]1ccn(CCCN)c1/N=N/c1cnn(CCCN)c1N |
| InChI | InChI=1S/C15H27N9/c1-2-7-22-10-11-23(8-3-5-16)15(22)21-20-13-12-19-24(14(13)18)9-4-6-17/h10-12,18H,2-9,16-17H2,1H3/p+1 |
| InChIKey | XABDYCQPRINXAW-UHFFFAOYSA-O |
| XLogP | 1.08 |
| TPSA | 129.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|