C9H20N5+ — CID 142305755
1,3-bis(3-aminopropyl)imidazol-1-ium-2-amine (PubChem CID 142305755) has the molecular formula C9H20N5+ and a molecular weight of 198.29 g/mol. Its IUPAC name is 1,3-bis(3-aminopropyl)imidazol-1-ium-2-amine.
| Compound Name | 1,3-bis(3-aminopropyl)imidazol-1-ium-2-amine |
|---|---|
| PubChem CID | 142305755 |
| Molecular Formula | C9H20N5+ |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1,3-bis(3-aminopropyl)imidazol-1-ium-2-amine |
| SMILES | NCCCn1cc[n+](CCCN)c1N |
| InChI | InChI=1S/C9H19N5/c10-3-1-5-13-7-8-14(9(13)12)6-2-4-11/h7-8,12H,1-6,10-11H2/p+1 |
| InChIKey | QLXCLASBXGUWOW-UHFFFAOYSA-O |
| XLogP | -0.94 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|