C23H42N7+3 — CID 59146689
3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-[3-(trimethylazaniumyl)propyl]anilino]propyl-trimethylazanium (PubChem CID 59146689) has the molecular formula C23H42N7+3 and a molecular weight of 416.64 g/mol. Its IUPAC name is 3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-[3-(trimethylazaniumyl)propyl]anilino]propyl-trimethylazanium.
| Compound Name | 3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-[3-(trimethylazaniumyl)propyl]anilino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 59146689 |
| Molecular Formula | C23H42N7+3 |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.35 |
| IUPAC Name | 3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-[3-(trimethylazaniumyl)propyl]anilino]propyl-trimethylazanium |
| SMILES | Cn1cc[n+](C)c1/N=N/c1ccc(N(CCC[N+](C)(C)C)CCC[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C23H42N7/c1-26-17-18-27(2)23(26)25-24-21-11-13-22(14-12-21)28(15-9-19-29(3,4)5)16-10-20-30(6,7)8/h11-14,17-18H,9-10,15-16,19-20H2,1-8H3/q+3 |
| InChIKey | CNOFVUOAIVIBTA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 36.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|