C16H16N2O4 — CID 102140808
6-[bis(2-hydroxyethyl)amino]benzo[de]isoquinoline-1,3-dione (PubChem CID 102140808) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 6-[bis(2-hydroxyethyl)amino]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-[bis(2-hydroxyethyl)amino]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102140808 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 6-[bis(2-hydroxyethyl)amino]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1NC(=O)c2ccc(N(CCO)CCO)c3cccc1c23 |
| InChI | InChI=1S/C16H16N2O4/c19-8-6-18(7-9-20)13-5-4-12-14-10(13)2-1-3-11(14)15(21)17-16(12)22/h1-5,19-20H,6-9H2,(H,17,21,22) |
| InChIKey | SJRWCXPZSNCKBS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|