C12H7NNiO2 — CID 175169723
benzo[de]isoquinoline-1,3-dione;nickel (PubChem CID 175169723) has the molecular formula C12H7NNiO2 and a molecular weight of 255.89 g/mol. Its IUPAC name is benzo[de]isoquinoline-1,3-dione;nickel.
| Compound Name | benzo[de]isoquinoline-1,3-dione;nickel |
|---|---|
| PubChem CID | 175169723 |
| Molecular Formula | C12H7NNiO2 |
| Molecular Weight | 255.89 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | benzo[de]isoquinoline-1,3-dione;nickel |
| SMILES | O=C1NC(=O)c2cccc3cccc1c23.[Ni] |
| InChI | InChI=1S/C12H7NO2.Ni/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13-11;/h1-6H,(H,13,14,15); |
| InChIKey | DTSYORPIABZBHH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.89 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|