C19H15NO7S2 — CID 68548548
benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene (PubChem CID 68548548) has the molecular formula C19H15NO7S2 and a molecular weight of 433.46 g/mol. Its IUPAC name is benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene.
| Compound Name | benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene |
|---|---|
| PubChem CID | 68548548 |
| Molecular Formula | C19H15NO7S2 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)S(=O)(=O)O)cc1.O=C1NC(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C12H7NO2.C7H8O5S2/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13-11;1-6-2-4-7(5-3-6)13(8,9)14(10,11)12/h1-6H,(H,13,14,15);2-5H,1H3,(H,10,11,12) |
| InChIKey | XEZWBAAVZAKJHO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|