About benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene
benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene (PubChem CID 68548548) has the molecular formula C19H15NO7S2
and a molecular weight of 433.46 g/mol. Its IUPAC name is benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene.
Molecular Properties
| Compound Name | benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene |
| PubChem CID | 68548548 |
| Molecular Formula | C19H15NO7S2 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)S(=O)(=O)O)cc1.O=C1NC(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C12H7NO2.C7H8O5S2/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13-11;1-6-2-4-7(5-3-6)13(8,9)14(10,11)12/h1-6H,(H,13,14,15);2-5H,1H3,(H,10,11,12) |
| InChIKey | XEZWBAAVZAKJHO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene?
The IUPAC name of benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene (CID 68548548) is benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene.
What is the SMILES notation for benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene?
The canonical SMILES for benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene is Cc1ccc(S(=O)(=O)S(=O)(=O)O)cc1.O=C1NC(=O)c2cccc3cccc1c23.
What is the InChIKey of benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene?
The InChIKey is XEZWBAAVZAKJHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO2.C7H8O5S2/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13-11;1-6-2-4-7(5-3-6)13(8,9)14(10,11)12/h1-6H,(H,13,14,15);2-5H,1H3,(H,10,11,12).
What are the key properties of benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene?
benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene has a molecular weight of 433.46 g/mol, XLogP of 2.29, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[de]isoquinoline-1,3-dione;1-methyl-4-sulfosulfonylbenzene is sourced from PubChem (CID 68548548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).