C16H12N4O2 — CID 174839176
benzo[de]isoquinoline-1,3-dione;pyrimidin-2-amine (PubChem CID 174839176) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is benzo[de]isoquinoline-1,3-dione;pyrimidin-2-amine.
| Compound Name | benzo[de]isoquinoline-1,3-dione;pyrimidin-2-amine |
|---|---|
| PubChem CID | 174839176 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | benzo[de]isoquinoline-1,3-dione;pyrimidin-2-amine |
| SMILES | Nc1ncccn1.O=C1NC(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C12H7NO2.C4H5N3/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13-11;5-4-6-2-1-3-7-4/h1-6H,(H,13,14,15);1-3H,(H2,5,6,7) |
| InChIKey | PGTAMRSZESHUBY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|