C17H19NO2S — CID 175340648
benzo[de]isoquinoline-1,3-dione;pentane-1-thiol (PubChem CID 175340648) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is benzo[de]isoquinoline-1,3-dione;pentane-1-thiol.
| Compound Name | benzo[de]isoquinoline-1,3-dione;pentane-1-thiol |
|---|---|
| PubChem CID | 175340648 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | benzo[de]isoquinoline-1,3-dione;pentane-1-thiol |
| SMILES | CCCCCS.O=C1NC(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C12H7NO2.C5H12S/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13-11;1-2-3-4-5-6/h1-6H,(H,13,14,15);6H,2-5H2,1H3 |
| InChIKey | LPYHUDXJZMLHOV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|