C25H37N5O2 — CID 164520011
2-[3-[bis(3-aminopropyl)amino]propyl]-6-(diethylamino)benzo[de]isoquinoline-1,3-dione (PubChem CID 164520011) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 2-[3-[bis(3-aminopropyl)amino]propyl]-6-(diethylamino)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[3-[bis(3-aminopropyl)amino]propyl]-6-(diethylamino)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 164520011 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 2-[3-[bis(3-aminopropyl)amino]propyl]-6-(diethylamino)benzo[de]isoquinoline-1,3-dione |
| SMILES | CCN(CC)c1ccc2c3c(cccc13)C(=O)N(CCCN(CCCN)CCCN)C2=O |
| InChI | InChI=1S/C25H37N5O2/c1-3-29(4-2)22-12-11-21-23-19(22)9-5-10-20(23)24(31)30(25(21)32)18-8-17-28(15-6-13-26)16-7-14-27/h5,9-12H,3-4,6-8,13-18,26-27H2,1-2H3 |
| InChIKey | GYIUYBTZCZRUHL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|