C20H17N7O5S — CID 121286158
azido 2-[6-(6-azidohex-1-ynyl)-1,3-dioxobenzo[de]isoquinolin-2-yl]ethanesulfonate (PubChem CID 121286158) has the molecular formula C20H17N7O5S and a molecular weight of 467.47 g/mol. Its IUPAC name is azido 2-[6-(6-azidohex-1-ynyl)-1,3-dioxobenzo[de]isoquinolin-2-yl]ethanesulfonate.
| Compound Name | azido 2-[6-(6-azidohex-1-ynyl)-1,3-dioxobenzo[de]isoquinolin-2-yl]ethanesulfonate |
|---|---|
| PubChem CID | 121286158 |
| Molecular Formula | C20H17N7O5S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | azido 2-[6-(6-azidohex-1-ynyl)-1,3-dioxobenzo[de]isoquinolin-2-yl]ethanesulfonate |
| SMILES | [N-]=[N+]=NCCCCC#Cc1ccc2c3c(cccc13)C(=O)N(CCS(=O)(=O)ON=[N+]=[N-])C2=O |
| InChI | InChI=1S/C20H17N7O5S/c21-24-23-11-4-2-1-3-6-14-9-10-17-18-15(14)7-5-8-16(18)19(28)27(20(17)29)12-13-33(30,31)32-26-25-22/h5,7-10H,1-2,4,11-13H2 |
| InChIKey | PRTKJWGUKZNVCG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 178.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|