C54H41N3O4 — CID 102398867
2-butyl-6-[2-[4-(N-[4-[2-(2-butyl-1,3-dioxobenzo[de]isoquinolin-6-yl)ethynyl]phenyl]anilino)phenyl]ethynyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 102398867) has the molecular formula C54H41N3O4 and a molecular weight of 795.94 g/mol. Its IUPAC name is 2-butyl-6-[2-[4-(N-[4-[2-(2-butyl-1,3-dioxobenzo[de]isoquinolin-6-yl)ethynyl]phenyl]anilino)phenyl]ethynyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-butyl-6-[2-[4-(N-[4-[2-(2-butyl-1,3-dioxobenzo[de]isoquinolin-6-yl)ethynyl]phenyl]anilino)phenyl]ethynyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102398867 |
| Molecular Formula | C54H41N3O4 |
| Molecular Weight | 795.94 g/mol |
| Exact Mass | 795.31 |
| IUPAC Name | 2-butyl-6-[2-[4-(N-[4-[2-(2-butyl-1,3-dioxobenzo[de]isoquinolin-6-yl)ethynyl]phenyl]anilino)phenyl]ethynyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCN1C(=O)c2cccc3c(C#Cc4ccc(N(c5ccccc5)c5ccc(C#Cc6ccc7c8c(cccc68)C(=O)N(CCCC)C7=O)cc5)cc4)ccc(c23)C1=O |
| InChI | InChI=1S/C54H41N3O4/c1-3-5-34-55-51(58)45-16-10-14-43-38(26-32-47(49(43)45)53(55)60)24-18-36-20-28-41(29-21-36)57(40-12-8-7-9-13-40)42-30-22-37(23-31-42)19-25-39-27-33-48-50-44(39)15-11-17-46(50)52(59)56(54(48)61)35-6-4-2/h7-17,20-23,26-33H,3-6,34-35H2,1-2H3 |
| InChIKey | AEIIYXROGXWPKQ-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.94 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|