C37H27N3O2 — CID 162640324
2-butyl-6-[4-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 162640324) has the molecular formula C37H27N3O2 and a molecular weight of 545.64 g/mol. Its IUPAC name is 2-butyl-6-[4-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-butyl-6-[4-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 162640324 |
| Molecular Formula | C37H27N3O2 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 2-butyl-6-[4-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCN1C(=O)c2cccc3c(-c4ccc(-c5nc6c7ccccc7c7ccccc7c6[nH]5)cc4)ccc(c23)C1=O |
| InChI | InChI=1S/C37H27N3O2/c1-2-3-21-40-36(41)30-14-8-13-27-24(19-20-31(32(27)30)37(40)42)22-15-17-23(18-16-22)35-38-33-28-11-6-4-9-25(28)26-10-5-7-12-29(26)34(33)39-35/h4-20H,2-3,21H2,1H3,(H,38,39) |
| InChIKey | MBZFTLZZYOUWNU-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|