C25H18N2O2 — CID 102216269
4-[2-(2-butyl-1,3-dioxobenzo[de]isoquinolin-6-yl)ethynyl]benzonitrile (PubChem CID 102216269) has the molecular formula C25H18N2O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is 4-[2-(2-butyl-1,3-dioxobenzo[de]isoquinolin-6-yl)ethynyl]benzonitrile.
| Compound Name | 4-[2-(2-butyl-1,3-dioxobenzo[de]isoquinolin-6-yl)ethynyl]benzonitrile |
|---|---|
| PubChem CID | 102216269 |
| Molecular Formula | C25H18N2O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 4-[2-(2-butyl-1,3-dioxobenzo[de]isoquinolin-6-yl)ethynyl]benzonitrile |
| SMILES | CCCCN1C(=O)c2cccc3c(C#Cc4ccc(C#N)cc4)ccc(c23)C1=O |
| InChI | InChI=1S/C25H18N2O2/c1-2-3-15-27-24(28)21-6-4-5-20-19(13-14-22(23(20)21)25(27)29)12-11-17-7-9-18(16-26)10-8-17/h4-10,13-14H,2-3,15H2,1H3 |
| InChIKey | YGHZWNGUXFTXGN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|