C26H22ClNO2 — CID 102216273
6-[2-(4-chlorophenyl)ethynyl]-2-hexylbenzo[de]isoquinoline-1,3-dione (PubChem CID 102216273) has the molecular formula C26H22ClNO2 and a molecular weight of 415.92 g/mol. Its IUPAC name is 6-[2-(4-chlorophenyl)ethynyl]-2-hexylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-[2-(4-chlorophenyl)ethynyl]-2-hexylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102216273 |
| Molecular Formula | C26H22ClNO2 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 6-[2-(4-chlorophenyl)ethynyl]-2-hexylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCCCN1C(=O)c2cccc3c(C#Cc4ccc(Cl)cc4)ccc(c23)C1=O |
| InChI | InChI=1S/C26H22ClNO2/c1-2-3-4-5-17-28-25(29)22-8-6-7-21-19(13-16-23(24(21)22)26(28)30)12-9-18-10-14-20(27)15-11-18/h6-8,10-11,13-16H,2-5,17H2,1H3 |
| InChIKey | YLXCAVNWQOMLOS-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|