C32H33NO3Si — CID 102219022
2-butyl-6-[tert-butyl(diphenyl)silyl]oxybenzo[de]isoquinoline-1,3-dione (PubChem CID 102219022) has the molecular formula C32H33NO3Si and a molecular weight of 507.71 g/mol. Its IUPAC name is 2-butyl-6-[tert-butyl(diphenyl)silyl]oxybenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-butyl-6-[tert-butyl(diphenyl)silyl]oxybenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102219022 |
| Molecular Formula | C32H33NO3Si |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 2-butyl-6-[tert-butyl(diphenyl)silyl]oxybenzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCN1C(=O)c2cccc3c(O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)ccc(c23)C1=O |
| InChI | InChI=1S/C32H33NO3Si/c1-5-6-22-33-30(34)26-19-13-18-25-28(21-20-27(29(25)26)31(33)35)36-37(32(2,3)4,23-14-9-7-10-15-23)24-16-11-8-12-17-24/h7-21H,5-6,22H2,1-4H3 |
| InChIKey | SOAXXKHPOZKLIK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|