C24H24N2O2Se — CID 70689394
2-butyl-6-(2-phenylselanylethylamino)benzo[de]isoquinoline-1,3-dione (PubChem CID 70689394) has the molecular formula C24H24N2O2Se and a molecular weight of 451.43 g/mol. Its IUPAC name is 2-butyl-6-(2-phenylselanylethylamino)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-butyl-6-(2-phenylselanylethylamino)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 70689394 |
| Molecular Formula | C24H24N2O2Se |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2-butyl-6-(2-phenylselanylethylamino)benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCN1C(=O)c2cccc3c(NCC[Se]c4ccccc4)ccc(c23)C1=O |
| InChI | InChI=1S/C24H24N2O2Se/c1-2-3-15-26-23(27)19-11-7-10-18-21(13-12-20(22(18)19)24(26)28)25-14-16-29-17-8-5-4-6-9-17/h4-13,25H,2-3,14-16H2,1H3 |
| InChIKey | SOBWJWVTKILDGU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|