C28H31N3O3SSi — CID 102358778
5-(2,1,3-benzothiadiazol-4-yl)-2-butyl-7-[tert-butyl(dimethyl)silyl]oxybenzo[de]isoquinoline-1,3-dione (PubChem CID 102358778) has the molecular formula C28H31N3O3SSi and a molecular weight of 517.73 g/mol. Its IUPAC name is 5-(2,1,3-benzothiadiazol-4-yl)-2-butyl-7-[tert-butyl(dimethyl)silyl]oxybenzo[de]isoquinoline-1,3-dione.
| Compound Name | 5-(2,1,3-benzothiadiazol-4-yl)-2-butyl-7-[tert-butyl(dimethyl)silyl]oxybenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102358778 |
| Molecular Formula | C28H31N3O3SSi |
| Molecular Weight | 517.73 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 5-(2,1,3-benzothiadiazol-4-yl)-2-butyl-7-[tert-butyl(dimethyl)silyl]oxybenzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCN1C(=O)c2ccc(O[Si](C)(C)C(C)(C)C)c3cc(-c4cccc5nsnc45)cc(c23)C1=O |
| InChI | InChI=1S/C28H31N3O3SSi/c1-7-8-14-31-26(32)19-12-13-23(34-36(5,6)28(2,3)4)20-15-17(16-21(24(19)20)27(31)33)18-10-9-11-22-25(18)30-35-29-22/h9-13,15-16H,7-8,14H2,1-6H3 |
| InChIKey | UBZYMLBAOWEDBP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.73 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|