C32H30N2O4 — CID 156857071
tert-butyl 4-[1,3-dioxo-6-(N-phenylanilino)benzo[de]isoquinolin-2-yl]butanoate (PubChem CID 156857071) has the molecular formula C32H30N2O4 and a molecular weight of 506.60 g/mol. Its IUPAC name is tert-butyl 4-[1,3-dioxo-6-(N-phenylanilino)benzo[de]isoquinolin-2-yl]butanoate.
| Compound Name | tert-butyl 4-[1,3-dioxo-6-(N-phenylanilino)benzo[de]isoquinolin-2-yl]butanoate |
|---|---|
| PubChem CID | 156857071 |
| Molecular Formula | C32H30N2O4 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | tert-butyl 4-[1,3-dioxo-6-(N-phenylanilino)benzo[de]isoquinolin-2-yl]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCN1C(=O)c2cccc3c(N(c4ccccc4)c4ccccc4)ccc(c23)C1=O |
| InChI | InChI=1S/C32H30N2O4/c1-32(2,3)38-28(35)18-11-21-33-30(36)25-17-10-16-24-27(20-19-26(29(24)25)31(33)37)34(22-12-6-4-7-13-22)23-14-8-5-9-15-23/h4-10,12-17,19-20H,11,18,21H2,1-3H3 |
| InChIKey | KKGWVANYDRHLMD-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|